Factory supply 2,4-dichloro-6-methoxyanilinium chloride 84254-93-3 with low price We provide high quality 2,4-dichloro-6-methoxyanilinium chloride (CAS 84254-93-3), at a very affordable prices to our customers.
1.What is the 2,4-dichloro-6-methoxyanilinium chloride ?
2,4-dichloro-6-methoxyanilinium chloride, an organic compound with the chemical formula C7H8Cl2NO, is a derivative of aniline characterized by the presence of two chlorine atoms and one methoxy group. This water-soluble compound is widely utilized in organic synthesis and chemical research, and is known for its potential applications in the production of dyes, pharmaceuticals, and pesticides. Due to its potential for irritation and toxicity, it is essential to handle and store 2,4-dichloro-6-methoxyanilinium chloride with appropriate safety measures.
Used in Organic Synthesis:
2,4-dichloro-6-methoxyanilinium chloride is used as a reagent in organic synthesis for its versatile chemical properties, enabling the creation of a variety of compounds with diverse applications.
Used in Chemical Research:
In the field of chemical research, 2,4-dichloro-6-methoxyanilinium chloride serves as a valuable compound for studying the effects of substituents on the chemical behavior of aniline derivatives.
Used in Dye Production:
2,4-dichloro-6-methoxyanilinium chloride is utilized as an intermediate in the production of various dyes, contributing to the development of colorants for different industries.
Used in Pharmaceutical Industry:
In the pharmaceutical sector, 2,4-dichloro-6-methoxyanilinium chloride is employed as a building block for the synthesis of specific drugs, playing a crucial role in the development of new medicinal compounds.
Used in Pesticide Formulation:
2,4-dichloro-6-methoxyanilinium chloride is also used in the formulation of pesticides, where its chemical properties contribute to the effectiveness of these agricultural chemicals in controlling pests and diseases.
2.What is the CAS number for 2,4-dichloro-6-methoxyanilinium chloride ?
The CAS number of 2,4-dichloro-6-methoxyanilinium chloride is 84254-93-3.
More information of 2,4-dichloro-6-methoxyanilinium chloride 84254-93-3 are:
|
CAS?Number |
84254-93-3 |
|
Boiling Point |
273.9°C at 760 mmHg |
|
Flash Point |
119.4°C |
|
Vapor Pressure |
0.00559mmHg at 25°C |
|
PSA |
35.25000 |
|
LogP |
3.96740 |
3.What is the molecular formula of 2,4-dichloro-6-methoxyanilinium chloride ?
The chemical formula of?2,4-dichloro-6-methoxyanilinium chloride is C7H7 Cl2 N O . Cl H which containing 7 Carbon atoms,8 Hydrogen atoms,3 Chlorine atoms and 1 Nitrogen atoms,and the molecular weight, and the molecular weight of 2,4-dichloro-6-methoxyanilinium chloride is 228.50352
4.What is 2,4-dichloro-6-methoxyanilinium chloride(84254-93-3)used for?
2,4-dichloro-6-methoxyanilinium chloride, an organic compound with the chemical formula C7H8Cl2NO, is a derivative of aniline characterized by the presence of two chlorine atoms and one methoxy group. This water-soluble compound is widely utilized in organic synthesis and chemical research, and is known for its potential applications in the production of dyes, pharmaceuticals, and pesticides. Due to its potential for irritation and toxicity, it is essential to handle and store 2,4-dichloro-6-methoxyanilinium chloride with appropriate safety measures.
InChI:InChI=1/C7H7Cl2NO.ClH/c1-11-6-3-4(8)2-5(9)7(6)10;/h2-3H,10H2,1H3;1H
Relevant articles related to 2,4-dichloro-6-methoxyanilinium chloride:
5.Factory supply 2,4-dichloro-6-methoxyanilinium chloride 84254-93-3 with low price
Hubei Aladdin Technology Industry Co.,Ltd is a quality supplier of 2,4-dichloro-6-methoxyanilinium chloride. Our main goal is customer satisfaction. Contact us to negotiate the best price for your business on 2,4-dichloro-6-methoxyanilinium chloride 84254-93-3.
